C32H34N2O8S — CID 58938158
[3-[[(7S)-3-cyclopentyloxy-1,2-dimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]phenyl]methyl nitrate (PubChem CID 58938158) has the molecular formula C32H34N2O8S and a molecular weight of 606.70 g/mol. Its IUPAC name is [3-[[(7S)-3-cyclopentyloxy-1,2-dimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]phenyl]methyl nitrate.
| Compound Name | [3-[[(7S)-3-cyclopentyloxy-1,2-dimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]phenyl]methyl nitrate |
|---|---|
| PubChem CID | 58938158 |
| Molecular Formula | C32H34N2O8S |
| Molecular Weight | 606.70 g/mol |
| Exact Mass | 606.20 |
| IUPAC Name | [3-[[(7S)-3-cyclopentyloxy-1,2-dimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]phenyl]methyl nitrate |
| SMILES | COc1c(OC2CCCC2)cc2c(c1OC)-c1ccc(SC)c(=O)cc1[C@@H](NC(=O)c1cccc(CO[N+](=O)[O-])c1)CC2 |
| InChI | InChI=1S/C32H34N2O8S/c1-39-30-27(42-22-9-4-5-10-22)16-20-11-13-25(33-32(36)21-8-6-7-19(15-21)18-41-34(37)38)24-17-26(35)28(43-3)14-12-23(24)29(20)31(30)40-2/h6-8,12,14-17,22,25H,4-5,9-11,13,18H2,1-3H3,(H,33,36)/t25-/m0/s1 |
| InChIKey | XEHOYCZSNKGEFW-VWLOTQADSA-N |
| XLogP | 5.90 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.70 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|