C31H33N3O10S — CID 58938171
[6-[[(7S)-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]-2-pyridinyl]methyl 4-nitrooxybutanoate (PubChem CID 58938171) has the molecular formula C31H33N3O10S and a molecular weight of 639.68 g/mol. Its IUPAC name is [6-[[(7S)-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]-2-pyridinyl]methyl 4-nitrooxybutanoate.
| Compound Name | [6-[[(7S)-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]-2-pyridinyl]methyl 4-nitrooxybutanoate |
|---|---|
| PubChem CID | 58938171 |
| Molecular Formula | C31H33N3O10S |
| Molecular Weight | 639.68 g/mol |
| Exact Mass | 639.19 |
| IUPAC Name | [6-[[(7S)-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]-2-pyridinyl]methyl 4-nitrooxybutanoate |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(SC)c(=O)cc1[C@@H](NC(=O)c1cccc(COC(=O)CCCO[N+](=O)[O-])n1)CC2 |
| InChI | InChI=1S/C31H33N3O10S/c1-40-25-15-18-10-12-22(21-16-24(35)26(45-4)13-11-20(21)28(18)30(42-3)29(25)41-2)33-31(37)23-8-5-7-19(32-23)17-43-27(36)9-6-14-44-34(38)39/h5,7-8,11,13,15-16,22H,6,9-10,12,14,17H2,1-4H3,(H,33,37)/t22-/m0/s1 |
| InChIKey | CBUAGFDWLGJORE-QFIPXVFZSA-N |
| XLogP | 4.31 |
| TPSA | 165.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.68 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|