C28H28N2O8S — CID 142685177
[2-[[(7S)-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]phenyl]methyl nitrate (PubChem CID 142685177) has the molecular formula C28H28N2O8S and a molecular weight of 552.61 g/mol. Its IUPAC name is [2-[[(7S)-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]phenyl]methyl nitrate.
| Compound Name | [2-[[(7S)-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]phenyl]methyl nitrate |
|---|---|
| PubChem CID | 142685177 |
| Molecular Formula | C28H28N2O8S |
| Molecular Weight | 552.61 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | [2-[[(7S)-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]phenyl]methyl nitrate |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(SC)c(=O)cc1[C@@H](NC(=O)c1ccccc1CO[N+](=O)[O-])CC2 |
| InChI | InChI=1S/C28H28N2O8S/c1-35-23-13-16-9-11-21(29-28(32)18-8-6-5-7-17(18)15-38-30(33)34)20-14-22(31)24(39-4)12-10-19(20)25(16)27(37-3)26(23)36-2/h5-8,10,12-14,21H,9,11,15H2,1-4H3,(H,29,32)/t21-/m0/s1 |
| InChIKey | DNXKXUJBXKGQOL-NRFANRHFSA-N |
| XLogP | 4.59 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.61 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|