C29H30N2O9 — CID 45269968
[3-[methyl-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]phenyl]methyl nitrate (PubChem CID 45269968) has the molecular formula C29H30N2O9 and a molecular weight of 550.56 g/mol. Its IUPAC name is [3-[methyl-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]phenyl]methyl nitrate.
| Compound Name | [3-[methyl-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]phenyl]methyl nitrate |
|---|---|
| PubChem CID | 45269968 |
| Molecular Formula | C29H30N2O9 |
| Molecular Weight | 550.56 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | [3-[methyl-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]phenyl]methyl nitrate |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(OC)c(=O)cc1[C@@H](N(C)C(=O)c1cccc(CO[N+](=O)[O-])c1)CC2 |
| InChI | InChI=1S/C29H30N2O9/c1-30(29(33)19-8-6-7-17(13-19)16-40-31(34)35)22-11-9-18-14-25(37-3)27(38-4)28(39-5)26(18)20-10-12-24(36-2)23(32)15-21(20)22/h6-8,10,12-15,22H,9,11,16H2,1-5H3/t22-/m0/s1 |
| InChIKey | JKSGRQXFLZOWRY-QFIPXVFZSA-N |
| XLogP | 4.22 |
| TPSA | 126.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|