C29H33NO6 — CID 4587108
10-ethoxy-7-[(2-hydroxyphenyl)methyl-methylamino]-1,2,3-trimethoxy-6,7-dihydro-5H-benzo[a]heptalen-9-one (PubChem CID 4587108) has the molecular formula C29H33NO6 and a molecular weight of 491.58 g/mol. Its IUPAC name is 10-ethoxy-7-[(2-hydroxyphenyl)methyl-methylamino]-1,2,3-trimethoxy-6,7-dihydro-5H-benzo[a]heptalen-9-one.
| Compound Name | 10-ethoxy-7-[(2-hydroxyphenyl)methyl-methylamino]-1,2,3-trimethoxy-6,7-dihydro-5H-benzo[a]heptalen-9-one |
|---|---|
| PubChem CID | 4587108 |
| Molecular Formula | C29H33NO6 |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 10-ethoxy-7-[(2-hydroxyphenyl)methyl-methylamino]-1,2,3-trimethoxy-6,7-dihydro-5H-benzo[a]heptalen-9-one |
| SMILES | CCOc1ccc2c(cc1=O)C(N(C)Cc1ccccc1O)CCc1cc(OC)c(OC)c(OC)c1-2 |
| InChI | InChI=1S/C29H33NO6/c1-6-36-25-14-12-20-21(16-24(25)32)22(30(2)17-19-9-7-8-10-23(19)31)13-11-18-15-26(33-3)28(34-4)29(35-5)27(18)20/h7-10,12,14-16,22,31H,6,11,13,17H2,1-5H3 |
| InChIKey | KYIAWOLWENFZEU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|