C21H27NO4 — CID 632120
5,13,14,15-tetramethoxy-N,N-dimethyltricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-8-amine (PubChem CID 632120) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is 5,13,14,15-tetramethoxy-N,N-dimethyltricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-8-amine.
| Compound Name | 5,13,14,15-tetramethoxy-N,N-dimethyltricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-8-amine |
|---|---|
| PubChem CID | 632120 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 5,13,14,15-tetramethoxy-N,N-dimethyltricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-8-amine |
| SMILES | COc1ccc2c(c1)C(N(C)C)CCc1cc(OC)c(OC)c(OC)c1-2 |
| InChI | InChI=1S/C21H27NO4/c1-22(2)17-10-7-13-11-18(24-4)20(25-5)21(26-6)19(13)15-9-8-14(23-3)12-16(15)17/h8-9,11-12,17H,7,10H2,1-6H3 |
| InChIKey | TXCJITNHLXZIKF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |