C27H29NO6 — CID 14832010
(7S)-10-hydroxy-7-[(2-hydroxyphenyl)methyl-methylamino]-1,2,3-trimethoxy-6,7-dihydro-5H-benzo[a]heptalen-9-one (PubChem CID 14832010) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is (7S)-10-hydroxy-7-[(2-hydroxyphenyl)methyl-methylamino]-1,2,3-trimethoxy-6,7-dihydro-5H-benzo[a]heptalen-9-one.
| Compound Name | (7S)-10-hydroxy-7-[(2-hydroxyphenyl)methyl-methylamino]-1,2,3-trimethoxy-6,7-dihydro-5H-benzo[a]heptalen-9-one |
|---|---|
| PubChem CID | 14832010 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | (7S)-10-hydroxy-7-[(2-hydroxyphenyl)methyl-methylamino]-1,2,3-trimethoxy-6,7-dihydro-5H-benzo[a]heptalen-9-one |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(O)c(=O)cc1[C@@H](N(C)Cc1ccccc1O)CC2 |
| InChI | InChI=1S/C27H29NO6/c1-28(15-17-7-5-6-8-21(17)29)20-11-9-16-13-24(32-2)26(33-3)27(34-4)25(16)18-10-12-22(30)23(31)14-19(18)20/h5-8,10,12-14,20,29H,9,11,15H2,1-4H3,(H,30,31)/t20-/m0/s1 |
| InChIKey | LRKICIBMVROIRW-FQEVSTJZSA-N |
| XLogP | 4.27 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|