C22H22F3NO6 — CID 4244902
2,2,2-trifluoro-N-(10-hydroxy-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl)-N-methylacetamide (PubChem CID 4244902) has the molecular formula C22H22F3NO6 and a molecular weight of 453.41 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(10-hydroxy-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl)-N-methylacetamide.
| Compound Name | 2,2,2-trifluoro-N-(10-hydroxy-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 4244902 |
| Molecular Formula | C22H22F3NO6 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 2,2,2-trifluoro-N-(10-hydroxy-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl)-N-methylacetamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(O)c(=O)cc1C(N(C)C(=O)C(F)(F)F)CC2 |
| InChI | InChI=1S/C22H22F3NO6/c1-26(21(29)22(23,24)25)14-7-5-11-9-17(30-2)19(31-3)20(32-4)18(11)12-6-8-15(27)16(28)10-13(12)14/h6,8-10,14H,5,7H2,1-4H3,(H,27,28) |
| InChIKey | BGKNQBHEZDTGMU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |