C26H34N4O7 — CID 40806671
(2R)-2-amino-6-[[(7S)-1,2,3-trimethoxy-7-[methyl(nitroso)amino]-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]hexanoic acid (PubChem CID 40806671) has the molecular formula C26H34N4O7 and a molecular weight of 514.58 g/mol. Its IUPAC name is (2R)-2-amino-6-[[(7S)-1,2,3-trimethoxy-7-[methyl(nitroso)amino]-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]hexanoic acid.
| Compound Name | (2R)-2-amino-6-[[(7S)-1,2,3-trimethoxy-7-[methyl(nitroso)amino]-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 40806671 |
| Molecular Formula | C26H34N4O7 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | (2R)-2-amino-6-[[(7S)-1,2,3-trimethoxy-7-[methyl(nitroso)amino]-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]hexanoic acid |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCC[C@@H](N)C(=O)O)c(=O)cc1[C@@H](N(C)N=O)CC2 |
| InChI | InChI=1S/C26H34N4O7/c1-30(29-34)20-11-8-15-13-22(35-2)24(36-3)25(37-4)23(15)16-9-10-19(21(31)14-17(16)20)28-12-6-5-7-18(27)26(32)33/h9-10,13-14,18,20H,5-8,11-12,27H2,1-4H3,(H,28,31)(H,32,33)/t18-,20+/m1/s1 |
| InChIKey | YQWRAPKMQMAMIT-QUCCMNQESA-N |
| XLogP | 3.33 |
| TPSA | 152.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|