C33H38N4O7 — CID 75491855
N-(4-acetamidophenyl)-4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]butanamide (PubChem CID 75491855) has the molecular formula C33H38N4O7 and a molecular weight of 602.69 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]butanamide.
| Compound Name | N-(4-acetamidophenyl)-4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]butanamide |
|---|---|
| PubChem CID | 75491855 |
| Molecular Formula | C33H38N4O7 |
| Molecular Weight | 602.69 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | N-(4-acetamidophenyl)-4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]butanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCC(=O)Nc3ccc(NC(C)=O)cc3)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C33H38N4O7/c1-19(38)35-22-9-11-23(12-10-22)37-30(41)7-6-16-34-27-15-13-24-25(18-28(27)40)26(36-20(2)39)14-8-21-17-29(42-3)32(43-4)33(44-5)31(21)24/h9-13,15,17-18,26H,6-8,14,16H2,1-5H3,(H,34,40)(H,35,38)(H,36,39)(H,37,41)/t26-/m0/s1 |
| InChIKey | YBMURDXOXTZLGU-SANMLTNESA-N |
| XLogP | 4.65 |
| TPSA | 144.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.69 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|