C34H38N4O6 — CID 75492388
4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(1-methylindol-6-yl)butanamide (PubChem CID 75492388) has the molecular formula C34H38N4O6 and a molecular weight of 598.70 g/mol. Its IUPAC name is 4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(1-methylindol-6-yl)butanamide.
| Compound Name | 4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(1-methylindol-6-yl)butanamide |
|---|---|
| PubChem CID | 75492388 |
| Molecular Formula | C34H38N4O6 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | 4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(1-methylindol-6-yl)butanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCC(=O)Nc3ccc4ccn(C)c4c3)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C34H38N4O6/c1-20(39)36-26-12-9-22-17-30(42-3)33(43-4)34(44-5)32(22)24-11-13-27(29(40)19-25(24)26)35-15-6-7-31(41)37-23-10-8-21-14-16-38(2)28(21)18-23/h8,10-11,13-14,16-19,26H,6-7,9,12,15H2,1-5H3,(H,35,40)(H,36,39)(H,37,41)/t26-/m0/s1 |
| InChIKey | QXHADGNCYANRDI-SANMLTNESA-N |
| XLogP | 5.19 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|