C34H41N3O9 — CID 163087972
4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-(3,4,5-trimethoxyphenyl)butanamide (PubChem CID 163087972) has the molecular formula C34H41N3O9 and a molecular weight of 635.71 g/mol. Its IUPAC name is 4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-(3,4,5-trimethoxyphenyl)butanamide.
| Compound Name | 4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-(3,4,5-trimethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 163087972 |
| Molecular Formula | C34H41N3O9 |
| Molecular Weight | 635.71 g/mol |
| Exact Mass | 635.28 |
| IUPAC Name | 4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-(3,4,5-trimethoxyphenyl)butanamide |
| SMILES | COc1cc(NC(=O)CCCNc2ccc3c(cc2=O)C(NC(C)=O)CCc2cc(OC)c(OC)c(OC)c2-3)cc(OC)c1OC |
| InChI | InChI=1S/C34H41N3O9/c1-19(38)36-24-12-10-20-15-27(41-2)33(45-6)34(46-7)31(20)22-11-13-25(26(39)18-23(22)24)35-14-8-9-30(40)37-21-16-28(42-3)32(44-5)29(17-21)43-4/h11,13,15-18,24H,8-10,12,14H2,1-7H3,(H,35,39)(H,36,38)(H,37,40) |
| InChIKey | CNMYOHRUGWIDPL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 142.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.71 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|