C35H41N5O6 — CID 124860283
6-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(1-methylbenzimidazol-5-yl)hexanamide (PubChem CID 124860283) has the molecular formula C35H41N5O6 and a molecular weight of 627.74 g/mol. Its IUPAC name is 6-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(1-methylbenzimidazol-5-yl)hexanamide.
| Compound Name | 6-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(1-methylbenzimidazol-5-yl)hexanamide |
|---|---|
| PubChem CID | 124860283 |
| Molecular Formula | C35H41N5O6 |
| Molecular Weight | 627.74 g/mol |
| Exact Mass | 627.31 |
| IUPAC Name | 6-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(1-methylbenzimidazol-5-yl)hexanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCCCC(=O)Nc3ccc4c(c3)ncn4C)c(=O)cc1[C@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C35H41N5O6/c1-21(41)38-26-13-10-22-17-31(44-3)34(45-4)35(46-5)33(22)24-12-14-27(30(42)19-25(24)26)36-16-8-6-7-9-32(43)39-23-11-15-29-28(18-23)37-20-40(29)2/h11-12,14-15,17-20,26H,6-10,13,16H2,1-5H3,(H,36,42)(H,38,41)(H,39,43)/t26-/m1/s1 |
| InChIKey | AVZPUZCVMCGHNX-AREMUKBSSA-N |
| XLogP | 5.36 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.74 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|