C34H42N4O6 — CID 163072928
6-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-(2-pyridin-4-ylethyl)hexanamide (PubChem CID 163072928) has the molecular formula C34H42N4O6 and a molecular weight of 602.73 g/mol. Its IUPAC name is 6-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-(2-pyridin-4-ylethyl)hexanamide.
| Compound Name | 6-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-(2-pyridin-4-ylethyl)hexanamide |
|---|---|
| PubChem CID | 163072928 |
| Molecular Formula | C34H42N4O6 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | 6-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-(2-pyridin-4-ylethyl)hexanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCCCC(=O)NCCc3ccncc3)c(=O)cc1C(NC(C)=O)CC2 |
| InChI | InChI=1S/C34H42N4O6/c1-22(39)38-27-11-9-24-20-30(42-2)33(43-3)34(44-4)32(24)25-10-12-28(29(40)21-26(25)27)36-16-7-5-6-8-31(41)37-19-15-23-13-17-35-18-14-23/h10,12-14,17-18,20-21,27H,5-9,11,15-16,19H2,1-4H3,(H,36,40)(H,37,41)(H,38,39) |
| InChIKey | UUCLAGFJWZBTTP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|