C32H39N3O7 — CID 75491520
6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(furan-2-ylmethyl)hexanamide (PubChem CID 75491520) has the molecular formula C32H39N3O7 and a molecular weight of 577.68 g/mol. Its IUPAC name is 6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(furan-2-ylmethyl)hexanamide.
| Compound Name | 6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(furan-2-ylmethyl)hexanamide |
|---|---|
| PubChem CID | 75491520 |
| Molecular Formula | C32H39N3O7 |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.28 |
| IUPAC Name | 6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(furan-2-ylmethyl)hexanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCCCC(=O)NCc3ccco3)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C32H39N3O7/c1-20(36)35-25-13-11-21-17-28(39-2)31(40-3)32(41-4)30(21)23-12-14-26(27(37)18-24(23)25)33-15-7-5-6-10-29(38)34-19-22-9-8-16-42-22/h8-9,12,14,16-18,25H,5-7,10-11,13,15,19H2,1-4H3,(H,33,37)(H,34,38)(H,35,36)/t25-/m0/s1 |
| InChIKey | PHYRYLLDPYGJIY-VWLOTQADSA-N |
| XLogP | 4.74 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|