C34H40N6O6 — CID 124864682
6-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)hexanamide (PubChem CID 124864682) has the molecular formula C34H40N6O6 and a molecular weight of 628.73 g/mol. Its IUPAC name is 6-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)hexanamide.
| Compound Name | 6-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)hexanamide |
|---|---|
| PubChem CID | 124864682 |
| Molecular Formula | C34H40N6O6 |
| Molecular Weight | 628.73 g/mol |
| Exact Mass | 628.30 |
| IUPAC Name | 6-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)hexanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCCCC(=O)NCc3nnc4ccccn34)c(=O)cc1[C@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C34H40N6O6/c1-21(41)37-25-14-12-22-18-28(44-2)33(45-3)34(46-4)32(22)23-13-15-26(27(42)19-24(23)25)35-16-8-5-6-11-31(43)36-20-30-39-38-29-10-7-9-17-40(29)30/h7,9-10,13,15,17-19,25H,5-6,8,11-12,14,16,20H2,1-4H3,(H,35,42)(H,36,43)(H,37,41)/t25-/m1/s1 |
| InChIKey | ZNUCLFJSFLHNEP-RUZDIDTESA-N |
| XLogP | 4.19 |
| TPSA | 145.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.73 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|