C37H45N3O8 — CID 162996766
methyl 2-[6-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]hexanoylamino]-3-phenylpropanoate (PubChem CID 162996766) has the molecular formula C37H45N3O8 and a molecular weight of 659.78 g/mol. Its IUPAC name is methyl 2-[6-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]hexanoylamino]-3-phenylpropanoate.
| Compound Name | methyl 2-[6-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]hexanoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 162996766 |
| Molecular Formula | C37H45N3O8 |
| Molecular Weight | 659.78 g/mol |
| Exact Mass | 659.32 |
| IUPAC Name | methyl 2-[6-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]hexanoylamino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)CCCCCNc1ccc2c(cc1=O)C(NC(C)=O)CCc1cc(OC)c(OC)c(OC)c1-2 |
| InChI | InChI=1S/C37H45N3O8/c1-23(41)39-28-17-15-25-21-32(45-2)35(46-3)36(47-4)34(25)26-16-18-29(31(42)22-27(26)28)38-19-11-7-10-14-33(43)40-30(37(44)48-5)20-24-12-8-6-9-13-24/h6,8-9,12-13,16,18,21-22,28,30H,7,10-11,14-15,17,19-20H2,1-5H3,(H,38,42)(H,39,41)(H,40,43) |
| InChIKey | GVXVKHFCRNLZEK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.78 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|