C30H41N3O6 — CID 110210019
6-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-propan-2-ylhexanamide (PubChem CID 110210019) has the molecular formula C30H41N3O6 and a molecular weight of 539.67 g/mol. Its IUPAC name is 6-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-propan-2-ylhexanamide.
| Compound Name | 6-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-propan-2-ylhexanamide |
|---|---|
| PubChem CID | 110210019 |
| Molecular Formula | C30H41N3O6 |
| Molecular Weight | 539.67 g/mol |
| Exact Mass | 539.30 |
| IUPAC Name | 6-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-propan-2-ylhexanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCCCC(=O)NC(C)C)c(=O)cc1C(NC(C)=O)CC2 |
| InChI | InChI=1S/C30H41N3O6/c1-18(2)32-27(36)10-8-7-9-15-31-24-14-12-21-22(17-25(24)35)23(33-19(3)34)13-11-20-16-26(37-4)29(38-5)30(39-6)28(20)21/h12,14,16-18,23H,7-11,13,15H2,1-6H3,(H,31,35)(H,32,36)(H,33,34) |
| InChIKey | SNLNEEJREOOWLU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.67 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|