C34H39N3O8 — CID 110207403
methyl (2S)-2-[4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]butanoylamino]-2-phenylacetate (PubChem CID 110207403) has the molecular formula C34H39N3O8 and a molecular weight of 617.70 g/mol. Its IUPAC name is methyl (2S)-2-[4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]butanoylamino]-2-phenylacetate.
| Compound Name | methyl (2S)-2-[4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]butanoylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 110207403 |
| Molecular Formula | C34H39N3O8 |
| Molecular Weight | 617.70 g/mol |
| Exact Mass | 617.27 |
| IUPAC Name | methyl (2S)-2-[4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]butanoylamino]-2-phenylacetate |
| SMILES | COC(=O)[C@@H](NC(=O)CCCNc1ccc2c(cc1=O)[C@@H](NC(C)=O)CCc1cc(OC)c(OC)c(OC)c1-2)c1ccccc1 |
| InChI | InChI=1S/C34H39N3O8/c1-20(38)36-25-15-13-22-18-28(42-2)32(43-3)33(44-4)30(22)23-14-16-26(27(39)19-24(23)25)35-17-9-12-29(40)37-31(34(41)45-5)21-10-7-6-8-11-21/h6-8,10-11,14,16,18-19,25,31H,9,12-13,15,17H2,1-5H3,(H,35,39)(H,36,38)(H,37,40)/t25-,31-/m0/s1 |
| InChIKey | AXMSOJKLYWPBSI-FKAPRUDGSA-N |
| XLogP | 4.09 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.70 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|