C33H39N3O6 — CID 75491405
6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-phenylhexanamide (PubChem CID 75491405) has the molecular formula C33H39N3O6 and a molecular weight of 573.69 g/mol. Its IUPAC name is 6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-phenylhexanamide.
| Compound Name | 6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-phenylhexanamide |
|---|---|
| PubChem CID | 75491405 |
| Molecular Formula | C33H39N3O6 |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.28 |
| IUPAC Name | 6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-phenylhexanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCCCC(=O)Nc3ccccc3)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C33H39N3O6/c1-21(37)35-26-16-14-22-19-29(40-2)32(41-3)33(42-4)31(22)24-15-17-27(28(38)20-25(24)26)34-18-10-6-9-13-30(39)36-23-11-7-5-8-12-23/h5,7-8,11-12,15,17,19-20,26H,6,9-10,13-14,16,18H2,1-4H3,(H,34,38)(H,35,37)(H,36,39)/t26-/m0/s1 |
| InChIKey | GMPFYMLAACQKMX-SANMLTNESA-N |
| XLogP | 5.47 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|