C32H41N5O6 — CID 124862796
6-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(1,5-dimethylpyrazol-3-yl)hexanamide (PubChem CID 124862796) has the molecular formula C32H41N5O6 and a molecular weight of 591.71 g/mol. Its IUPAC name is 6-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(1,5-dimethylpyrazol-3-yl)hexanamide.
| Compound Name | 6-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(1,5-dimethylpyrazol-3-yl)hexanamide |
|---|---|
| PubChem CID | 124862796 |
| Molecular Formula | C32H41N5O6 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.31 |
| IUPAC Name | 6-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(1,5-dimethylpyrazol-3-yl)hexanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCCCC(=O)Nc3cc(C)n(C)n3)c(=O)cc1[C@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C32H41N5O6/c1-19-16-28(36-37(19)3)35-29(40)10-8-7-9-15-33-25-14-12-22-23(18-26(25)39)24(34-20(2)38)13-11-21-17-27(41-4)31(42-5)32(43-6)30(21)22/h12,14,16-18,24H,7-11,13,15H2,1-6H3,(H,33,39)(H,34,38)(H,35,36,40)/t24-/m1/s1 |
| InChIKey | OQELXRYZYAFYOX-XMMPIXPASA-N |
| XLogP | 4.52 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|