C30H36N4O6S — CID 75491236
4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)butanamide (PubChem CID 75491236) has the molecular formula C30H36N4O6S and a molecular weight of 580.71 g/mol. Its IUPAC name is 4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)butanamide.
| Compound Name | 4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 75491236 |
| Molecular Formula | C30H36N4O6S |
| Molecular Weight | 580.71 g/mol |
| Exact Mass | 580.24 |
| IUPAC Name | 4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)butanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCC(=O)Nc3nc(C)c(C)s3)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C30H36N4O6S/c1-16-17(2)41-30(32-16)34-26(37)8-7-13-31-23-12-10-20-21(15-24(23)36)22(33-18(3)35)11-9-19-14-25(38-4)28(39-5)29(40-6)27(19)20/h10,12,14-15,22H,7-9,11,13H2,1-6H3,(H,31,36)(H,33,35)(H,32,34,37)/t22-/m0/s1 |
| InChIKey | MTRQWRKOFLEZLX-QFIPXVFZSA-N |
| XLogP | 4.77 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.71 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|