C36H38N4O8S — CID 124906488
methyl 2-[4-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]butanoylamino]-5-phenyl-1,3-thiazole-4-carboxylate (PubChem CID 124906488) has the molecular formula C36H38N4O8S and a molecular weight of 686.79 g/mol. Its IUPAC name is methyl 2-[4-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]butanoylamino]-5-phenyl-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[4-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]butanoylamino]-5-phenyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 124906488 |
| Molecular Formula | C36H38N4O8S |
| Molecular Weight | 686.79 g/mol |
| Exact Mass | 686.24 |
| IUPAC Name | methyl 2-[4-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]butanoylamino]-5-phenyl-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc(NC(=O)CCCNc2ccc3c(cc2=O)[C@H](NC(C)=O)CCc2cc(OC)c(OC)c(OC)c2-3)sc1-c1ccccc1 |
| InChI | InChI=1S/C36H38N4O8S/c1-20(41)38-25-15-13-22-18-28(45-2)32(46-3)33(47-4)30(22)23-14-16-26(27(42)19-24(23)25)37-17-9-12-29(43)39-36-40-31(35(44)48-5)34(49-36)21-10-7-6-8-11-21/h6-8,10-11,14,16,18-19,25H,9,12-13,15,17H2,1-5H3,(H,37,42)(H,38,41)(H,39,40,43)/t25-/m1/s1 |
| InChIKey | AYIQEJCDNSIPBO-RUZDIDTESA-N |
| XLogP | 5.60 |
| TPSA | 154.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.79 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|