C34H38N4O6S — CID 126417463
6-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(1,3-benzothiazol-2-yl)hexanamide (PubChem CID 126417463) has the molecular formula C34H38N4O6S and a molecular weight of 630.77 g/mol. Its IUPAC name is 6-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(1,3-benzothiazol-2-yl)hexanamide.
| Compound Name | 6-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(1,3-benzothiazol-2-yl)hexanamide |
|---|---|
| PubChem CID | 126417463 |
| Molecular Formula | C34H38N4O6S |
| Molecular Weight | 630.77 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | 6-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(1,3-benzothiazol-2-yl)hexanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCCCC(=O)Nc3nc4ccccc4s3)c(=O)cc1[C@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C34H38N4O6S/c1-20(39)36-24-15-13-21-18-28(42-2)32(43-3)33(44-4)31(21)22-14-16-25(27(40)19-23(22)24)35-17-9-5-6-12-30(41)38-34-37-26-10-7-8-11-29(26)45-34/h7-8,10-11,14,16,18-19,24H,5-6,9,12-13,15,17H2,1-4H3,(H,35,40)(H,36,39)(H,37,38,41)/t24-/m1/s1 |
| InChIKey | DDVPJPJYDFJEJC-XMMPIXPASA-N |
| XLogP | 6.08 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.77 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|