C34H42N4O8S — CID 91637072
ethyl 2-[6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]hexanoylamino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 91637072) has the molecular formula C34H42N4O8S and a molecular weight of 666.80 g/mol. Its IUPAC name is ethyl 2-[6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]hexanoylamino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]hexanoylamino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 91637072 |
| Molecular Formula | C34H42N4O8S |
| Molecular Weight | 666.80 g/mol |
| Exact Mass | 666.27 |
| IUPAC Name | ethyl 2-[6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]hexanoylamino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)CCCCCNc2ccc3c(cc2=O)[C@@H](NC(C)=O)CCc2cc(OC)c(OC)c(OC)c2-3)nc1C |
| InChI | InChI=1S/C34H42N4O8S/c1-7-46-33(42)32-19(2)36-34(47-32)38-28(41)11-9-8-10-16-35-25-15-13-22-23(18-26(25)40)24(37-20(3)39)14-12-21-17-27(43-4)30(44-5)31(45-6)29(21)22/h13,15,17-18,24H,7-12,14,16H2,1-6H3,(H,35,40)(H,37,39)(H,36,38,41)/t24-/m0/s1 |
| InChIKey | CHEVKQMWOBKFKU-DEOSSOPVSA-N |
| XLogP | 5.42 |
| TPSA | 154.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.80 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|