C33H40N4O8S — CID 75491834
methyl 2-[4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]butanoylamino]-5-propan-2-yl-1,3-thiazole-4-carboxylate (PubChem CID 75491834) has the molecular formula C33H40N4O8S and a molecular weight of 652.77 g/mol. Its IUPAC name is methyl 2-[4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]butanoylamino]-5-propan-2-yl-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]butanoylamino]-5-propan-2-yl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 75491834 |
| Molecular Formula | C33H40N4O8S |
| Molecular Weight | 652.77 g/mol |
| Exact Mass | 652.26 |
| IUPAC Name | methyl 2-[4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]butanoylamino]-5-propan-2-yl-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc(NC(=O)CCCNc2ccc3c(cc2=O)[C@@H](NC(C)=O)CCc2cc(OC)c(OC)c(OC)c2-3)sc1C(C)C |
| InChI | InChI=1S/C33H40N4O8S/c1-17(2)31-28(32(41)45-7)37-33(46-31)36-26(40)9-8-14-34-23-13-11-20-21(16-24(23)39)22(35-18(3)38)12-10-19-15-25(42-4)29(43-5)30(44-6)27(19)20/h11,13,15-17,22H,8-10,12,14H2,1-7H3,(H,34,39)(H,35,38)(H,36,37,40)/t22-/m0/s1 |
| InChIKey | MKPRMFINEUMJHB-QFIPXVFZSA-N |
| XLogP | 5.06 |
| TPSA | 154.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.77 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|