C32H34N4O6S2 — CID 110206878
4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)butanamide (PubChem CID 110206878) has the molecular formula C32H34N4O6S2 and a molecular weight of 634.78 g/mol. Its IUPAC name is 4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)butanamide.
| Compound Name | 4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 110206878 |
| Molecular Formula | C32H34N4O6S2 |
| Molecular Weight | 634.78 g/mol |
| Exact Mass | 634.19 |
| IUPAC Name | 4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)butanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCC(=O)Nc3nc(-c4cccs4)cs3)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C32H34N4O6S2/c1-18(37)34-22-11-9-19-15-26(40-2)30(41-3)31(42-4)29(19)20-10-12-23(25(38)16-21(20)22)33-13-5-8-28(39)36-32-35-24(17-44-32)27-7-6-14-43-27/h6-7,10,12,14-17,22H,5,8-9,11,13H2,1-4H3,(H,33,38)(H,34,37)(H,35,36,39)/t22-/m0/s1 |
| InChIKey | GRCZUVBQZLCPRB-QFIPXVFZSA-N |
| XLogP | 5.88 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.78 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|