C35H36N4O8S — CID 127252785
4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]butanamide (PubChem CID 127252785) has the molecular formula C35H36N4O8S and a molecular weight of 672.76 g/mol. Its IUPAC name is 4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 127252785 |
| Molecular Formula | C35H36N4O8S |
| Molecular Weight | 672.76 g/mol |
| Exact Mass | 672.23 |
| IUPAC Name | 4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]butanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCC(=O)Nc3nc(-c4ccc5c(c4)OCO5)cs3)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C35H36N4O8S/c1-19(40)37-24-10-7-21-15-30(43-2)33(44-3)34(45-4)32(21)22-9-11-25(27(41)16-23(22)24)36-13-5-6-31(42)39-35-38-26(17-48-35)20-8-12-28-29(14-20)47-18-46-28/h8-9,11-12,14-17,24H,5-7,10,13,18H2,1-4H3,(H,36,41)(H,37,40)(H,38,39,42)/t24-/m0/s1 |
| InChIKey | KBCJVGPOVKUWML-DEOSSOPVSA-N |
| XLogP | 5.55 |
| TPSA | 146.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.76 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|