C39H43N5O7S — CID 91637055
6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[4-(5-methoxy-1H-indol-3-yl)-1,3-thiazol-2-yl]hexanamide (PubChem CID 91637055) has the molecular formula C39H43N5O7S and a molecular weight of 725.87 g/mol. Its IUPAC name is 6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[4-(5-methoxy-1H-indol-3-yl)-1,3-thiazol-2-yl]hexanamide.
| Compound Name | 6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[4-(5-methoxy-1H-indol-3-yl)-1,3-thiazol-2-yl]hexanamide |
|---|---|
| PubChem CID | 91637055 |
| Molecular Formula | C39H43N5O7S |
| Molecular Weight | 725.87 g/mol |
| Exact Mass | 725.29 |
| IUPAC Name | 6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[4-(5-methoxy-1H-indol-3-yl)-1,3-thiazol-2-yl]hexanamide |
| SMILES | COc1ccc2[nH]cc(-c3csc(NC(=O)CCCCCNc4ccc5c(cc4=O)[C@@H](NC(C)=O)CCc4cc(OC)c(OC)c(OC)c4-5)n3)c2c1 |
| InChI | InChI=1S/C39H43N5O7S/c1-22(45)42-30-13-10-23-17-34(49-3)37(50-4)38(51-5)36(23)25-12-15-31(33(46)19-27(25)30)40-16-8-6-7-9-35(47)44-39-43-32(21-52-39)28-20-41-29-14-11-24(48-2)18-26(28)29/h11-12,14-15,17-21,30,41H,6-10,13,16H2,1-5H3,(H,40,46)(H,42,45)(H,43,44,47)/t30-/m0/s1 |
| InChIKey | QMWZMKBHVKUFCU-PMERELPUSA-N |
| XLogP | 7.09 |
| TPSA | 152.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.87 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|