C32H38N4O6S — CID 110210502
4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)butanamide (PubChem CID 110210502) has the molecular formula C32H38N4O6S and a molecular weight of 606.75 g/mol. Its IUPAC name is 4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)butanamide.
| Compound Name | 4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 110210502 |
| Molecular Formula | C32H38N4O6S |
| Molecular Weight | 606.75 g/mol |
| Exact Mass | 606.25 |
| IUPAC Name | 4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)butanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCC(=O)Nc3nc4c(s3)CCCC4)c(=O)cc1C(NC(C)=O)CC2 |
| InChI | InChI=1S/C32H38N4O6S/c1-18(37)34-22-13-11-19-16-26(40-2)30(41-3)31(42-4)29(19)20-12-14-23(25(38)17-21(20)22)33-15-7-10-28(39)36-32-35-24-8-5-6-9-27(24)43-32/h12,14,16-17,22H,5-11,13,15H2,1-4H3,(H,33,38)(H,34,37)(H,35,36,39) |
| InChIKey | VOGYIBYGDYQKLO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.75 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|