C34H42N4O6S — CID 124868530
(2R,3S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pentanamide (PubChem CID 124868530) has the molecular formula C34H42N4O6S and a molecular weight of 634.80 g/mol. Its IUPAC name is (2R,3S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pentanamide.
| Compound Name | (2R,3S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 124868530 |
| Molecular Formula | C34H42N4O6S |
| Molecular Weight | 634.80 g/mol |
| Exact Mass | 634.28 |
| IUPAC Name | (2R,3S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pentanamide |
| SMILES | CC[C@H](C)[C@@H](Nc1ccc2c(cc1=O)[C@@H](NC(C)=O)CCc1cc(OC)c(OC)c(OC)c1-2)C(=O)Nc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C34H42N4O6S/c1-7-18(2)30(33(41)38-34-37-25-10-8-9-11-28(25)45-34)36-24-15-13-21-22(17-26(24)40)23(35-19(3)39)14-12-20-16-27(42-4)31(43-5)32(44-6)29(20)21/h13,15-18,23,30H,7-12,14H2,1-6H3,(H,35,39)(H,36,40)(H,37,38,41)/t18-,23-,30+/m0/s1 |
| InChIKey | LFTFQPDEMBRDOM-SYENHDJVSA-N |
| XLogP | 5.66 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.80 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |