C35H42N4O7 — CID 75492495
(2S,3R)-N-(4-acetamidophenyl)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methylpentanamide (PubChem CID 75492495) has the molecular formula C35H42N4O7 and a molecular weight of 630.74 g/mol. Its IUPAC name is (2S,3R)-N-(4-acetamidophenyl)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methylpentanamide.
| Compound Name | (2S,3R)-N-(4-acetamidophenyl)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methylpentanamide |
|---|---|
| PubChem CID | 75492495 |
| Molecular Formula | C35H42N4O7 |
| Molecular Weight | 630.74 g/mol |
| Exact Mass | 630.31 |
| IUPAC Name | (2S,3R)-N-(4-acetamidophenyl)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methylpentanamide |
| SMILES | CC[C@@H](C)[C@H](Nc1ccc2c(cc1=O)[C@@H](NC(C)=O)CCc1cc(OC)c(OC)c(OC)c1-2)C(=O)Nc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C35H42N4O7/c1-8-19(2)32(35(43)38-24-12-10-23(11-13-24)36-20(3)40)39-28-16-14-25-26(18-29(28)42)27(37-21(4)41)15-9-22-17-30(44-5)33(45-6)34(46-7)31(22)25/h10-14,16-19,27,32H,8-9,15H2,1-7H3,(H,36,40)(H,37,41)(H,38,43)(H,39,42)/t19-,27+,32+/m1/s1 |
| InChIKey | XXFLSMQIECWWAG-CKTVZQCPSA-N |
| XLogP | 5.29 |
| TPSA | 144.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.74 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |