C38H43N5O7 — CID 127252796
(2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-[4-(1-methylimidazole-2-carbonyl)phenyl]pentanamide (PubChem CID 127252796) has the molecular formula C38H43N5O7 and a molecular weight of 681.79 g/mol. Its IUPAC name is (2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-[4-(1-methylimidazole-2-carbonyl)phenyl]pentanamide.
| Compound Name | (2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-[4-(1-methylimidazole-2-carbonyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 127252796 |
| Molecular Formula | C38H43N5O7 |
| Molecular Weight | 681.79 g/mol |
| Exact Mass | 681.32 |
| IUPAC Name | (2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-[4-(1-methylimidazole-2-carbonyl)phenyl]pentanamide |
| SMILES | CC[C@@H](C)[C@H](Nc1ccc2c(cc1=O)[C@@H](NC(C)=O)CCc1cc(OC)c(OC)c(OC)c1-2)C(=O)Nc1ccc(C(=O)c2nccn2C)cc1 |
| InChI | InChI=1S/C38H43N5O7/c1-8-21(2)33(38(47)41-25-12-9-23(10-13-25)34(46)37-39-17-18-43(37)4)42-29-16-14-26-27(20-30(29)45)28(40-22(3)44)15-11-24-19-31(48-5)35(49-6)36(50-7)32(24)26/h9-10,12-14,16-21,28,33H,8,11,15H2,1-7H3,(H,40,44)(H,41,47)(H,42,45)/t21-,28+,33+/m1/s1 |
| InChIKey | UHCHCRNWDQPBAG-VGASRGCDSA-N |
| XLogP | 5.29 |
| TPSA | 149.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.79 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |