C32H43N3O8 — CID 110207304
methyl 4-[[(2S,3S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methylpentanoyl]amino]butanoate (PubChem CID 110207304) has the molecular formula C32H43N3O8 and a molecular weight of 597.71 g/mol. Its IUPAC name is methyl 4-[[(2S,3S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methylpentanoyl]amino]butanoate.
| Compound Name | methyl 4-[[(2S,3S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methylpentanoyl]amino]butanoate |
|---|---|
| PubChem CID | 110207304 |
| Molecular Formula | C32H43N3O8 |
| Molecular Weight | 597.71 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | methyl 4-[[(2S,3S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methylpentanoyl]amino]butanoate |
| SMILES | CC[C@H](C)[C@H](Nc1ccc2c(cc1=O)[C@@H](NC(C)=O)CCc1cc(OC)c(OC)c(OC)c1-2)C(=O)NCCCC(=O)OC |
| InChI | InChI=1S/C32H43N3O8/c1-8-18(2)29(32(39)33-15-9-10-27(38)41-5)35-24-14-12-21-22(17-25(24)37)23(34-19(3)36)13-11-20-16-26(40-4)30(42-6)31(43-7)28(20)21/h12,14,16-18,23,29H,8-11,13,15H2,1-7H3,(H,33,39)(H,34,36)(H,35,37)/t18-,23-,29-/m0/s1 |
| InChIKey | TYXNHOQIRMJPAM-GMXDNTTCSA-N |
| XLogP | 3.76 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.71 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|