C36H45N3O7 — CID 75492594
(2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[2-(2-methoxyphenyl)ethyl]-3-methylpentanamide (PubChem CID 75492594) has the molecular formula C36H45N3O7 and a molecular weight of 631.77 g/mol. Its IUPAC name is (2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[2-(2-methoxyphenyl)ethyl]-3-methylpentanamide.
| Compound Name | (2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[2-(2-methoxyphenyl)ethyl]-3-methylpentanamide |
|---|---|
| PubChem CID | 75492594 |
| Molecular Formula | C36H45N3O7 |
| Molecular Weight | 631.77 g/mol |
| Exact Mass | 631.33 |
| IUPAC Name | (2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[2-(2-methoxyphenyl)ethyl]-3-methylpentanamide |
| SMILES | CC[C@@H](C)[C@H](Nc1ccc2c(cc1=O)[C@@H](NC(C)=O)CCc1cc(OC)c(OC)c(OC)c1-2)C(=O)NCCc1ccccc1OC |
| InChI | InChI=1S/C36H45N3O7/c1-8-21(2)33(36(42)37-18-17-23-11-9-10-12-30(23)43-4)39-28-16-14-25-26(20-29(28)41)27(38-22(3)40)15-13-24-19-31(44-5)34(45-6)35(46-7)32(24)25/h9-12,14,16,19-21,27,33H,8,13,15,17-18H2,1-7H3,(H,37,42)(H,38,40)(H,39,41)/t21-,27+,33+/m1/s1 |
| InChIKey | GKTQYKSKYAEWCP-BSHLTOHISA-N |
| XLogP | 5.06 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.77 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |