C38H44N4O6S — CID 162893806
2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-3-methyl-N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]pentanamide (PubChem CID 162893806) has the molecular formula C38H44N4O6S and a molecular weight of 684.86 g/mol. Its IUPAC name is 2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-3-methyl-N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]pentanamide.
| Compound Name | 2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-3-methyl-N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 162893806 |
| Molecular Formula | C38H44N4O6S |
| Molecular Weight | 684.86 g/mol |
| Exact Mass | 684.30 |
| IUPAC Name | 2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-3-methyl-N-[2-(4-phenyl-1,3-thiazol-2-yl)ethyl]pentanamide |
| SMILES | CCC(C)C(Nc1ccc2c(cc1=O)C(NC(C)=O)CCc1cc(OC)c(OC)c(OC)c1-2)C(=O)NCCc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C38H44N4O6S/c1-7-22(2)35(38(45)39-18-17-33-41-30(21-49-33)24-11-9-8-10-12-24)42-29-16-14-26-27(20-31(29)44)28(40-23(3)43)15-13-25-19-32(46-4)36(47-5)37(48-6)34(25)26/h8-12,14,16,19-22,28,35H,7,13,15,17-18H2,1-6H3,(H,39,45)(H,40,43)(H,42,44) |
| InChIKey | VALUSZQUVFDSFI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.86 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |