C36H45N3O9 — CID 110209957
2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-3-methyl-N-(3,4,5-trimethoxyphenyl)pentanamide (PubChem CID 110209957) has the molecular formula C36H45N3O9 and a molecular weight of 663.77 g/mol. Its IUPAC name is 2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-3-methyl-N-(3,4,5-trimethoxyphenyl)pentanamide.
| Compound Name | 2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-3-methyl-N-(3,4,5-trimethoxyphenyl)pentanamide |
|---|---|
| PubChem CID | 110209957 |
| Molecular Formula | C36H45N3O9 |
| Molecular Weight | 663.77 g/mol |
| Exact Mass | 663.32 |
| IUPAC Name | 2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-3-methyl-N-(3,4,5-trimethoxyphenyl)pentanamide |
| SMILES | CCC(C)C(Nc1ccc2c(cc1=O)C(NC(C)=O)CCc1cc(OC)c(OC)c(OC)c1-2)C(=O)Nc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C36H45N3O9/c1-10-19(2)32(36(42)38-22-16-29(44-5)33(46-7)30(17-22)45-6)39-26-14-12-23-24(18-27(26)41)25(37-20(3)40)13-11-21-15-28(43-4)34(47-8)35(48-9)31(21)23/h12,14-19,25,32H,10-11,13H2,1-9H3,(H,37,40)(H,38,42)(H,39,41) |
| InChIKey | QSWDXSNFFMRNDS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 142.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.77 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |