C33H45N3O7 — CID 75491328
(2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-(oxan-4-ylmethyl)pentanamide (PubChem CID 75491328) has the molecular formula C33H45N3O7 and a molecular weight of 595.74 g/mol. Its IUPAC name is (2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-(oxan-4-ylmethyl)pentanamide.
| Compound Name | (2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-(oxan-4-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 75491328 |
| Molecular Formula | C33H45N3O7 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.33 |
| IUPAC Name | (2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-(oxan-4-ylmethyl)pentanamide |
| SMILES | CC[C@@H](C)[C@H](Nc1ccc2c(cc1=O)[C@@H](NC(C)=O)CCc1cc(OC)c(OC)c(OC)c1-2)C(=O)NCC1CCOCC1 |
| InChI | InChI=1S/C33H45N3O7/c1-7-19(2)30(33(39)34-18-21-12-14-43-15-13-21)36-26-11-9-23-24(17-27(26)38)25(35-20(3)37)10-8-22-16-28(40-4)31(41-5)32(42-6)29(22)23/h9,11,16-17,19,21,25,30H,7-8,10,12-15,18H2,1-6H3,(H,34,39)(H,35,37)(H,36,38)/t19-,25+,30+/m1/s1 |
| InChIKey | NBUVLDWCAWCQKO-PFTPNIEWSA-N |
| XLogP | 4.23 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |