C31H39N5O7 — CID 163093156
2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-3-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pentanamide (PubChem CID 163093156) has the molecular formula C31H39N5O7 and a molecular weight of 593.68 g/mol. Its IUPAC name is 2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-3-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pentanamide.
| Compound Name | 2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-3-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pentanamide |
|---|---|
| PubChem CID | 163093156 |
| Molecular Formula | C31H39N5O7 |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.28 |
| IUPAC Name | 2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-3-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pentanamide |
| SMILES | CCC(C)C(Nc1ccc2c(cc1=O)C(NC(C)=O)CCc1cc(OC)c(OC)c(OC)c1-2)C(=O)NCc1nc(C)no1 |
| InChI | InChI=1S/C31H39N5O7/c1-8-16(2)28(31(39)32-15-26-33-17(3)36-43-26)35-23-12-10-20-21(14-24(23)38)22(34-18(4)37)11-9-19-13-25(40-5)29(41-6)30(42-7)27(19)20/h10,12-14,16,22,28H,8-9,11,15H2,1-7H3,(H,32,39)(H,34,37)(H,35,38) |
| InChIKey | CPXGWYIHFQQRGP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 153.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |