C34H42N4O8S — CID 124863238
(2S,3S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-[(4-sulfamoylphenyl)methyl]pentanamide (PubChem CID 124863238) has the molecular formula C34H42N4O8S and a molecular weight of 666.80 g/mol. Its IUPAC name is (2S,3S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-[(4-sulfamoylphenyl)methyl]pentanamide.
| Compound Name | (2S,3S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-[(4-sulfamoylphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 124863238 |
| Molecular Formula | C34H42N4O8S |
| Molecular Weight | 666.80 g/mol |
| Exact Mass | 666.27 |
| IUPAC Name | (2S,3S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-[(4-sulfamoylphenyl)methyl]pentanamide |
| SMILES | CC[C@H](C)[C@H](Nc1ccc2c(cc1=O)[C@@H](NC(C)=O)CCc1cc(OC)c(OC)c(OC)c1-2)C(=O)NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C34H42N4O8S/c1-7-19(2)31(34(41)36-18-21-8-11-23(12-9-21)47(35,42)43)38-27-15-13-24-25(17-28(27)40)26(37-20(3)39)14-10-22-16-29(44-4)32(45-5)33(46-6)30(22)24/h8-9,11-13,15-17,19,26,31H,7,10,14,18H2,1-6H3,(H,36,41)(H,37,39)(H,38,40)(H2,35,42,43)/t19-,26-,31-/m0/s1 |
| InChIKey | RDVLNWVVJVTYLP-GIKDVTHCSA-N |
| XLogP | 3.65 |
| TPSA | 175.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.80 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |