C36H45N3O8 — CID 124861951
(2S)-2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methylbutanamide (PubChem CID 124861951) has the molecular formula C36H45N3O8 and a molecular weight of 647.77 g/mol. Its IUPAC name is (2S)-2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methylbutanamide.
| Compound Name | (2S)-2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 124861951 |
| Molecular Formula | C36H45N3O8 |
| Molecular Weight | 647.77 g/mol |
| Exact Mass | 647.32 |
| IUPAC Name | (2S)-2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methylbutanamide |
| SMILES | COc1ccc(CCNC(=O)[C@@H](Nc2ccc3c(cc2=O)[C@H](NC(C)=O)CCc2cc(OC)c(OC)c(OC)c2-3)C(C)C)cc1OC |
| InChI | InChI=1S/C36H45N3O8/c1-20(2)33(36(42)37-16-15-22-9-14-29(43-4)30(17-22)44-5)39-27-13-11-24-25(19-28(27)41)26(38-21(3)40)12-10-23-18-31(45-6)34(46-7)35(47-8)32(23)24/h9,11,13-14,17-20,26,33H,10,12,15-16H2,1-8H3,(H,37,42)(H,38,40)(H,39,41)/t26-,33+/m1/s1 |
| InChIKey | KKIIFBJNQDMZFE-NYFMKLKXSA-N |
| XLogP | 4.68 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.77 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |