C38H49N3O8 — CID 124879452
(2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[(1R)-1-(3,4-dimethoxyphenyl)-2-methylpropyl]-3-methylbutanamide (PubChem CID 124879452) has the molecular formula C38H49N3O8 and a molecular weight of 675.82 g/mol. Its IUPAC name is (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[(1R)-1-(3,4-dimethoxyphenyl)-2-methylpropyl]-3-methylbutanamide.
| Compound Name | (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[(1R)-1-(3,4-dimethoxyphenyl)-2-methylpropyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 124879452 |
| Molecular Formula | C38H49N3O8 |
| Molecular Weight | 675.82 g/mol |
| Exact Mass | 675.35 |
| IUPAC Name | (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[(1R)-1-(3,4-dimethoxyphenyl)-2-methylpropyl]-3-methylbutanamide |
| SMILES | COc1ccc([C@H](NC(=O)[C@@H](Nc2ccc3c(cc2=O)[C@@H](NC(C)=O)CCc2cc(OC)c(OC)c(OC)c2-3)C(C)C)C(C)C)cc1OC |
| InChI | InChI=1S/C38H49N3O8/c1-20(2)34(24-12-16-30(45-6)31(18-24)46-7)41-38(44)35(21(3)4)40-28-15-13-25-26(19-29(28)43)27(39-22(5)42)14-11-23-17-32(47-8)36(48-9)37(49-10)33(23)25/h12-13,15-21,27,34-35H,11,14H2,1-10H3,(H,39,42)(H,40,43)(H,41,44)/t27-,34+,35-/m0/s1 |
| InChIKey | SZIDHUZRFCXAOI-ULOURMHMSA-N |
| XLogP | 5.83 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.82 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |