C37H47N3O8 — CID 163093173
4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[1-(3,4-dimethoxyphenyl)-2-methylpropyl]butanamide (PubChem CID 163093173) has the molecular formula C37H47N3O8 and a molecular weight of 661.80 g/mol. Its IUPAC name is 4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[1-(3,4-dimethoxyphenyl)-2-methylpropyl]butanamide.
| Compound Name | 4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[1-(3,4-dimethoxyphenyl)-2-methylpropyl]butanamide |
|---|---|
| PubChem CID | 163093173 |
| Molecular Formula | C37H47N3O8 |
| Molecular Weight | 661.80 g/mol |
| Exact Mass | 661.34 |
| IUPAC Name | 4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[1-(3,4-dimethoxyphenyl)-2-methylpropyl]butanamide |
| SMILES | COc1ccc(C(NC(=O)CCCNc2ccc3c(cc2=O)C(NC(C)=O)CCc2cc(OC)c(OC)c(OC)c2-3)C(C)C)cc1OC |
| InChI | InChI=1S/C37H47N3O8/c1-21(2)35(24-12-16-30(44-4)31(19-24)45-5)40-33(43)10-9-17-38-28-15-13-25-26(20-29(28)42)27(39-22(3)41)14-11-23-18-32(46-6)36(47-7)37(48-8)34(23)25/h12-13,15-16,18-21,27,35H,9-11,14,17H2,1-8H3,(H,38,42)(H,39,41)(H,40,43) |
| InChIKey | PWSKDKASCIIDJJ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.80 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|