C29H37N3O8 — CID 163090470
4-[4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]butanoylamino]butanoic acid (PubChem CID 163090470) has the molecular formula C29H37N3O8 and a molecular weight of 555.63 g/mol. Its IUPAC name is 4-[4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]butanoylamino]butanoic acid.
| Compound Name | 4-[4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]butanoylamino]butanoic acid |
|---|---|
| PubChem CID | 163090470 |
| Molecular Formula | C29H37N3O8 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | 4-[4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]butanoylamino]butanoic acid |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCC(=O)NCCCC(=O)O)c(=O)cc1C(NC(C)=O)CC2 |
| InChI | InChI=1S/C29H37N3O8/c1-17(33)32-21-11-9-18-15-24(38-2)28(39-3)29(40-4)27(18)19-10-12-22(23(34)16-20(19)21)30-13-5-7-25(35)31-14-6-8-26(36)37/h10,12,15-16,21H,5-9,11,13-14H2,1-4H3,(H,30,34)(H,31,35)(H,32,33)(H,36,37) |
| InChIKey | AICNYQJAIVZQEK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|