C33H43N3O6 — CID 163088243
4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[2-(cyclohexen-1-yl)ethyl]butanamide (PubChem CID 163088243) has the molecular formula C33H43N3O6 and a molecular weight of 577.72 g/mol. Its IUPAC name is 4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[2-(cyclohexen-1-yl)ethyl]butanamide.
| Compound Name | 4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[2-(cyclohexen-1-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 163088243 |
| Molecular Formula | C33H43N3O6 |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.32 |
| IUPAC Name | 4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[2-(cyclohexen-1-yl)ethyl]butanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCC(=O)NCCC3=CCCCC3)c(=O)cc1C(NC(C)=O)CC2 |
| InChI | InChI=1S/C33H43N3O6/c1-21(37)36-26-14-12-23-19-29(40-2)32(41-3)33(42-4)31(23)24-13-15-27(28(38)20-25(24)26)34-17-8-11-30(39)35-18-16-22-9-6-5-7-10-22/h9,13,15,19-20,26H,5-8,10-12,14,16-18H2,1-4H3,(H,34,38)(H,35,39)(H,36,37) |
| InChIKey | HYONKAXWLIIRIN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|