C29H39N3O6 — CID 97489230
4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[(2S)-butan-2-yl]butanamide (PubChem CID 97489230) has the molecular formula C29H39N3O6 and a molecular weight of 525.65 g/mol. Its IUPAC name is 4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[(2S)-butan-2-yl]butanamide.
| Compound Name | 4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[(2S)-butan-2-yl]butanamide |
|---|---|
| PubChem CID | 97489230 |
| Molecular Formula | C29H39N3O6 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | 4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[(2S)-butan-2-yl]butanamide |
| SMILES | CC[C@H](C)NC(=O)CCCNc1ccc2c(cc1=O)[C@@H](NC(C)=O)CCc1cc(OC)c(OC)c(OC)c1-2 |
| InChI | InChI=1S/C29H39N3O6/c1-7-17(2)31-26(35)9-8-14-30-23-13-11-20-21(16-24(23)34)22(32-18(3)33)12-10-19-15-25(36-4)28(37-5)29(38-6)27(19)20/h11,13,15-17,22H,7-10,12,14H2,1-6H3,(H,30,34)(H,31,35)(H,32,33)/t17-,22-/m0/s1 |
| InChIKey | OYHHJCJXTQZYCI-JTSKRJEESA-N |
| XLogP | 3.97 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|