C31H41N3O8 — CID 163090053
2-[4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]butanoylamino]-3-methylpentanoic acid (PubChem CID 163090053) has the molecular formula C31H41N3O8 and a molecular weight of 583.68 g/mol. Its IUPAC name is 2-[4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]butanoylamino]-3-methylpentanoic acid.
| Compound Name | 2-[4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]butanoylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 163090053 |
| Molecular Formula | C31H41N3O8 |
| Molecular Weight | 583.68 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | 2-[4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]butanoylamino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)CCCNc1ccc2c(cc1=O)C(NC(C)=O)CCc1cc(OC)c(OC)c(OC)c1-2)C(=O)O |
| InChI | InChI=1S/C31H41N3O8/c1-7-17(2)28(31(38)39)34-26(37)9-8-14-32-23-13-11-20-21(16-24(23)36)22(33-18(3)35)12-10-19-15-25(40-4)29(41-5)30(42-6)27(19)20/h11,13,15-17,22,28H,7-10,12,14H2,1-6H3,(H,32,36)(H,33,35)(H,34,37)(H,38,39) |
| InChIKey | BKGMBKWOGOKVGW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.68 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|