C29H37N3O6 — CID 163088023
2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-3-methyl-N-prop-2-enylbutanamide (PubChem CID 163088023) has the molecular formula C29H37N3O6 and a molecular weight of 523.63 g/mol. Its IUPAC name is 2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-3-methyl-N-prop-2-enylbutanamide.
| Compound Name | 2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-3-methyl-N-prop-2-enylbutanamide |
|---|---|
| PubChem CID | 163088023 |
| Molecular Formula | C29H37N3O6 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | 2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-3-methyl-N-prop-2-enylbutanamide |
| SMILES | C=CCNC(=O)C(Nc1ccc2c(cc1=O)C(NC(C)=O)CCc1cc(OC)c(OC)c(OC)c1-2)C(C)C |
| InChI | InChI=1S/C29H37N3O6/c1-8-13-30-29(35)26(16(2)3)32-22-12-10-19-20(15-23(22)34)21(31-17(4)33)11-9-18-14-24(36-5)27(37-6)28(38-7)25(18)19/h8,10,12,14-16,21,26H,1,9,11,13H2,2-7H3,(H,30,35)(H,31,33)(H,32,34) |
| InChIKey | LTUZQAMUEVLRNQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|