C32H41N5O6 — CID 110207041
(2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-(2-pyrazol-1-ylethyl)pentanamide (PubChem CID 110207041) has the molecular formula C32H41N5O6 and a molecular weight of 591.71 g/mol. Its IUPAC name is (2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-(2-pyrazol-1-ylethyl)pentanamide.
| Compound Name | (2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-(2-pyrazol-1-ylethyl)pentanamide |
|---|---|
| PubChem CID | 110207041 |
| Molecular Formula | C32H41N5O6 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.31 |
| IUPAC Name | (2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-(2-pyrazol-1-ylethyl)pentanamide |
| SMILES | CC[C@@H](C)[C@H](Nc1ccc2c(cc1=O)[C@@H](NC(C)=O)CCc1cc(OC)c(OC)c(OC)c1-2)C(=O)NCCn1cccn1 |
| InChI | InChI=1S/C32H41N5O6/c1-7-19(2)29(32(40)33-14-16-37-15-8-13-34-37)36-25-12-10-22-23(18-26(25)39)24(35-20(3)38)11-9-21-17-27(41-4)30(42-5)31(43-6)28(21)22/h8,10,12-13,15,17-19,24,29H,7,9,11,14,16H2,1-6H3,(H,33,40)(H,35,38)(H,36,39)/t19-,24+,29+/m1/s1 |
| InChIKey | DDQNGCALAFLOSQ-CHNYNYQGSA-N |
| XLogP | 3.70 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |