C39H44N4O8S — CID 127252640
ethyl 2-[[(2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methylpentanoyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate (PubChem CID 127252640) has the molecular formula C39H44N4O8S and a molecular weight of 728.87 g/mol. Its IUPAC name is ethyl 2-[[(2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methylpentanoyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[[(2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methylpentanoyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 127252640 |
| Molecular Formula | C39H44N4O8S |
| Molecular Weight | 728.87 g/mol |
| Exact Mass | 728.29 |
| IUPAC Name | ethyl 2-[[(2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methylpentanoyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)[C@@H](Nc2ccc3c(cc2=O)[C@@H](NC(C)=O)CCc2cc(OC)c(OC)c(OC)c2-3)[C@H](C)CC)nc1-c1ccccc1 |
| InChI | InChI=1S/C39H44N4O8S/c1-8-21(3)32(37(46)43-39-42-33(23-13-11-10-12-14-23)36(52-39)38(47)51-9-2)41-28-18-16-25-26(20-29(28)45)27(40-22(4)44)17-15-24-19-30(48-5)34(49-6)35(50-7)31(24)25/h10-14,16,18-21,27,32H,8-9,15,17H2,1-7H3,(H,40,44)(H,41,45)(H,42,43,46)/t21-,27+,32+/m1/s1 |
| InChIKey | WFQMRODVEYZRFJ-BBQOZMKKSA-N |
| XLogP | 6.63 |
| TPSA | 154.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.87 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |